C30H28N2O6 — CID 3272035
3-(1-benzofuran-2-carbonyl)-2-(4-butoxy-3-methoxyphenyl)-4-hydroxy-1-(pyridin-4-ylmethyl)-2H-pyrrol-5-one (PubChem CID 3272035) has the molecular formula C30H28N2O6 and a molecular weight of 512.56 g/mol. Its IUPAC name is 3-(1-benzofuran-2-carbonyl)-2-(4-butoxy-3-methoxyphenyl)-4-hydroxy-1-(pyridin-4-ylmethyl)-2H-pyrrol-5-one.
| Compound Name | 3-(1-benzofuran-2-carbonyl)-2-(4-butoxy-3-methoxyphenyl)-4-hydroxy-1-(pyridin-4-ylmethyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 3272035 |
| Molecular Formula | C30H28N2O6 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | 3-(1-benzofuran-2-carbonyl)-2-(4-butoxy-3-methoxyphenyl)-4-hydroxy-1-(pyridin-4-ylmethyl)-2H-pyrrol-5-one |
| SMILES | CCCCOc1ccc(C2C(C(=O)c3cc4ccccc4o3)=C(O)C(=O)N2Cc2ccncc2)cc1OC |
| InChI | InChI=1S/C30H28N2O6/c1-3-4-15-37-23-10-9-21(17-24(23)36-2)27-26(28(33)25-16-20-7-5-6-8-22(20)38-25)29(34)30(35)32(27)18-19-11-13-31-14-12-19/h5-14,16-17,27,34H,3-4,15,18H2,1-2H3 |
| InChIKey | UJLRIBAHQYJQNU-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 102.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|