C29H30Cl2N2O3 — CID 3272595
7,9-dichloro-5-(3-methoxy-4-pentoxyphenyl)-2-(4-methylphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine (PubChem CID 3272595) has the molecular formula C29H30Cl2N2O3 and a molecular weight of 525.48 g/mol. Its IUPAC name is 7,9-dichloro-5-(3-methoxy-4-pentoxyphenyl)-2-(4-methylphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine.
| Compound Name | 7,9-dichloro-5-(3-methoxy-4-pentoxyphenyl)-2-(4-methylphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine |
|---|---|
| PubChem CID | 3272595 |
| Molecular Formula | C29H30Cl2N2O3 |
| Molecular Weight | 525.48 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | 7,9-dichloro-5-(3-methoxy-4-pentoxyphenyl)-2-(4-methylphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine |
| SMILES | CCCCCOc1ccc(C2Oc3c(Cl)cc(Cl)cc3C3CC(c4ccc(C)cc4)=NN32)cc1OC |
| InChI | InChI=1S/C29H30Cl2N2O3/c1-4-5-6-13-35-26-12-11-20(14-27(26)34-3)29-33-25(22-15-21(30)16-23(31)28(22)36-29)17-24(32-33)19-9-7-18(2)8-10-19/h7-12,14-16,25,29H,4-6,13,17H2,1-3H3 |
| InChIKey | RRVTZYIYMWOASL-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.48 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|