C30H32Cl2N2O5 — CID 98142307
(5S,10bS)-7,9-dichloro-2-(3,4-dimethoxyphenyl)-5-(3-methoxy-4-pentoxyphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine (PubChem CID 98142307) has the molecular formula C30H32Cl2N2O5 and a molecular weight of 571.50 g/mol. Its IUPAC name is (5S,10bS)-7,9-dichloro-2-(3,4-dimethoxyphenyl)-5-(3-methoxy-4-pentoxyphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine.
| Compound Name | (5S,10bS)-7,9-dichloro-2-(3,4-dimethoxyphenyl)-5-(3-methoxy-4-pentoxyphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine |
|---|---|
| PubChem CID | 98142307 |
| Molecular Formula | C30H32Cl2N2O5 |
| Molecular Weight | 571.50 g/mol |
| Exact Mass | 570.17 |
| IUPAC Name | (5S,10bS)-7,9-dichloro-2-(3,4-dimethoxyphenyl)-5-(3-methoxy-4-pentoxyphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine |
| SMILES | CCCCCOc1ccc([C@@H]2Oc3c(Cl)cc(Cl)cc3[C@@H]3CC(c4ccc(OC)c(OC)c4)=NN32)cc1OC |
| InChI | InChI=1S/C30H32Cl2N2O5/c1-5-6-7-12-38-26-11-9-19(14-28(26)37-4)30-34-24(21-15-20(31)16-22(32)29(21)39-30)17-23(33-34)18-8-10-25(35-2)27(13-18)36-3/h8-11,13-16,24,30H,5-7,12,17H2,1-4H3/t24-,30-/m0/s1 |
| InChIKey | SJLUMCWVDVZWIY-NGQVCNFZSA-N |
| XLogP | 7.83 |
| TPSA | 61.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.50 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|