C15H10Cl2IN3O2S — CID 3277746
N-[4-(4,5-dichloroimidazol-1-yl)phenyl]-4-iodobenzenesulfonamide (PubChem CID 3277746) has the molecular formula C15H10Cl2IN3O2S and a molecular weight of 494.14 g/mol. Its IUPAC name is N-[4-(4,5-dichloroimidazol-1-yl)phenyl]-4-iodobenzenesulfonamide.
| Compound Name | N-[4-(4,5-dichloroimidazol-1-yl)phenyl]-4-iodobenzenesulfonamide |
|---|---|
| PubChem CID | 3277746 |
| Molecular Formula | C15H10Cl2IN3O2S |
| Molecular Weight | 494.14 g/mol |
| Exact Mass | 492.89 |
| IUPAC Name | N-[4-(4,5-dichloroimidazol-1-yl)phenyl]-4-iodobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(-n2cnc(Cl)c2Cl)cc1)c1ccc(I)cc1 |
| InChI | InChI=1S/C15H10Cl2IN3O2S/c16-14-15(17)21(9-19-14)12-5-3-11(4-6-12)20-24(22,23)13-7-1-10(18)2-8-13/h1-9,20H |
| InChIKey | RJNIOSGPGFORDD-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.14 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|