C17H23ClN6OS — CID 32778183
[4-[(4-tert-butyl-5-sulfanylidenetetrazol-1-yl)methyl]piperazin-1-yl]-(4-chlorophenyl)methanone (PubChem CID 32778183) has the molecular formula C17H23ClN6OS and a molecular weight of 394.93 g/mol. Its IUPAC name is [4-[(4-tert-butyl-5-sulfanylidenetetrazol-1-yl)methyl]piperazin-1-yl]-(4-chlorophenyl)methanone.
| Compound Name | [4-[(4-tert-butyl-5-sulfanylidenetetrazol-1-yl)methyl]piperazin-1-yl]-(4-chlorophenyl)methanone |
|---|---|
| PubChem CID | 32778183 |
| Molecular Formula | C17H23ClN6OS |
| Molecular Weight | 394.93 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | [4-[(4-tert-butyl-5-sulfanylidenetetrazol-1-yl)methyl]piperazin-1-yl]-(4-chlorophenyl)methanone |
| SMILES | CC(C)(C)n1nnn(CN2CCN(C(=O)c3ccc(Cl)cc3)CC2)c1=S |
| InChI | InChI=1S/C17H23ClN6OS/c1-17(2,3)24-16(26)23(19-20-24)12-21-8-10-22(11-9-21)15(25)13-4-6-14(18)7-5-13/h4-7H,8-12H2,1-3H3 |
| InChIKey | WXMIWPMOTNLDLH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 59.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.93 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|