C18H24N8OS — CID 32802996
2-N,4-N-diethyl-6-[3-[2-(4-methylphenoxy)ethylsulfanyl]-1,2,4-triazol-1-yl]-1,3,5-triazine-2,4-diamine (PubChem CID 32802996) has the molecular formula C18H24N8OS and a molecular weight of 400.51 g/mol. Its IUPAC name is 2-N,4-N-diethyl-6-[3-[2-(4-methylphenoxy)ethylsulfanyl]-1,2,4-triazol-1-yl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-diethyl-6-[3-[2-(4-methylphenoxy)ethylsulfanyl]-1,2,4-triazol-1-yl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 32802996 |
| Molecular Formula | C18H24N8OS |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 2-N,4-N-diethyl-6-[3-[2-(4-methylphenoxy)ethylsulfanyl]-1,2,4-triazol-1-yl]-1,3,5-triazine-2,4-diamine |
| SMILES | CCNc1nc(NCC)nc(-n2cnc(SCCOc3ccc(C)cc3)n2)n1 |
| InChI | InChI=1S/C18H24N8OS/c1-4-19-15-22-16(20-5-2)24-17(23-15)26-12-21-18(25-26)28-11-10-27-14-8-6-13(3)7-9-14/h6-9,12H,4-5,10-11H2,1-3H3,(H2,19,20,22,23,24) |
| InChIKey | GMTTWFJWFLTKPA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|