C18H24N8S — CID 45133323
6-(3-benzylsulfanyl-1,2,4-triazol-1-yl)-2-N-butan-2-yl-4-N-ethyl-1,3,5-triazine-2,4-diamine (PubChem CID 45133323) has the molecular formula C18H24N8S and a molecular weight of 384.51 g/mol. Its IUPAC name is 6-(3-benzylsulfanyl-1,2,4-triazol-1-yl)-2-N-butan-2-yl-4-N-ethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(3-benzylsulfanyl-1,2,4-triazol-1-yl)-2-N-butan-2-yl-4-N-ethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 45133323 |
| Molecular Formula | C18H24N8S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 6-(3-benzylsulfanyl-1,2,4-triazol-1-yl)-2-N-butan-2-yl-4-N-ethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCNc1nc(NC(C)CC)nc(-n2cnc(SCc3ccccc3)n2)n1 |
| InChI | InChI=1S/C18H24N8S/c1-4-13(3)21-16-22-15(19-5-2)23-17(24-16)26-12-20-18(25-26)27-11-14-9-7-6-8-10-14/h6-10,12-13H,4-5,11H2,1-3H3,(H2,19,21,22,23,24) |
| InChIKey | KZJGKYGWDOOXSU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |