C20H28N8OS — CID 45133338
2-N-butan-2-yl-4-N,4-N-dimethyl-6-[3-[2-(2-methylphenoxy)ethylsulfanyl]-1,2,4-triazol-1-yl]-1,3,5-triazine-2,4-diamine (PubChem CID 45133338) has the molecular formula C20H28N8OS and a molecular weight of 428.57 g/mol. Its IUPAC name is 2-N-butan-2-yl-4-N,4-N-dimethyl-6-[3-[2-(2-methylphenoxy)ethylsulfanyl]-1,2,4-triazol-1-yl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-butan-2-yl-4-N,4-N-dimethyl-6-[3-[2-(2-methylphenoxy)ethylsulfanyl]-1,2,4-triazol-1-yl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 45133338 |
| Molecular Formula | C20H28N8OS |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 2-N-butan-2-yl-4-N,4-N-dimethyl-6-[3-[2-(2-methylphenoxy)ethylsulfanyl]-1,2,4-triazol-1-yl]-1,3,5-triazine-2,4-diamine |
| SMILES | CCC(C)Nc1nc(N(C)C)nc(-n2cnc(SCCOc3ccccc3C)n2)n1 |
| InChI | InChI=1S/C20H28N8OS/c1-6-15(3)22-17-23-18(27(4)5)25-19(24-17)28-13-21-20(26-28)30-12-11-29-16-10-8-7-9-14(16)2/h7-10,13,15H,6,11-12H2,1-5H3,(H,22,23,24,25) |
| InChIKey | VAMSOPGCMXPHOZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|