C16H16BrN3OS — CID 3280460
1-[(2-bromobenzoyl)amino]-3-(2,4-dimethylphenyl)thiourea (PubChem CID 3280460) has the molecular formula C16H16BrN3OS and a molecular weight of 378.30 g/mol. Its IUPAC name is 1-[(2-bromobenzoyl)amino]-3-(2,4-dimethylphenyl)thiourea.
| Compound Name | 1-[(2-bromobenzoyl)amino]-3-(2,4-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 3280460 |
| Molecular Formula | C16H16BrN3OS |
| Molecular Weight | 378.30 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | 1-[(2-bromobenzoyl)amino]-3-(2,4-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NNC(=O)c2ccccc2Br)c(C)c1 |
| InChI | InChI=1S/C16H16BrN3OS/c1-10-7-8-14(11(2)9-10)18-16(22)20-19-15(21)12-5-3-4-6-13(12)17/h3-9H,1-2H3,(H,19,21)(H2,18,20,22) |
| InChIKey | DIGCVFCUCZDRPA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.30 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|