C10H10N8O4 — CID 3281440
N'-(3,5-diamino-1,2,4-triazol-4-yl)-N-(4-nitrophenyl)oxamide (PubChem CID 3281440) has the molecular formula C10H10N8O4 and a molecular weight of 306.24 g/mol. Its IUPAC name is N'-(3,5-diamino-1,2,4-triazol-4-yl)-N-(4-nitrophenyl)oxamide.
| Compound Name | N'-(3,5-diamino-1,2,4-triazol-4-yl)-N-(4-nitrophenyl)oxamide |
|---|---|
| PubChem CID | 3281440 |
| Molecular Formula | C10H10N8O4 |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | N'-(3,5-diamino-1,2,4-triazol-4-yl)-N-(4-nitrophenyl)oxamide |
| SMILES | Nc1nnc(N)n1NC(=O)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H10N8O4/c11-9-14-15-10(12)17(9)16-8(20)7(19)13-5-1-3-6(4-2-5)18(21)22/h1-4H,(H2,11,14)(H2,12,15)(H,13,19)(H,16,20) |
| InChIKey | XPVWWKWSWSNNOB-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 184.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|