C10H8N6O4 — CID 3834481
N-(4-nitrophenyl)-N'-(1,2,4-triazol-4-yl)oxamide (PubChem CID 3834481) has the molecular formula C10H8N6O4 and a molecular weight of 276.21 g/mol. Its IUPAC name is N-(4-nitrophenyl)-N'-(1,2,4-triazol-4-yl)oxamide.
| Compound Name | N-(4-nitrophenyl)-N'-(1,2,4-triazol-4-yl)oxamide |
|---|---|
| PubChem CID | 3834481 |
| Molecular Formula | C10H8N6O4 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | N-(4-nitrophenyl)-N'-(1,2,4-triazol-4-yl)oxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)C(=O)Nn1cnnc1 |
| InChI | InChI=1S/C10H8N6O4/c17-9(10(18)14-15-5-11-12-6-15)13-7-1-3-8(4-2-7)16(19)20/h1-6H,(H,13,17)(H,14,18) |
| InChIKey | PYADMFVREFOZLR-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 132.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|