C21H18Cl2N2O3S — CID 32815386
N-[2-(3-chlorophenyl)ethyl]-4-[(2-chlorophenyl)sulfamoyl]benzamide (PubChem CID 32815386) has the molecular formula C21H18Cl2N2O3S and a molecular weight of 449.36 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-4-[(2-chlorophenyl)sulfamoyl]benzamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-4-[(2-chlorophenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 32815386 |
| Molecular Formula | C21H18Cl2N2O3S |
| Molecular Weight | 449.36 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-4-[(2-chlorophenyl)sulfamoyl]benzamide |
| SMILES | O=C(NCCc1cccc(Cl)c1)c1ccc(S(=O)(=O)Nc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C21H18Cl2N2O3S/c22-17-5-3-4-15(14-17)12-13-24-21(26)16-8-10-18(11-9-16)29(27,28)25-20-7-2-1-6-19(20)23/h1-11,14,25H,12-13H2,(H,24,26) |
| InChIKey | CWEXNAWVMNYULZ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.36 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |