C28H24ClN3O4S — CID 43915504
4-(benzenesulfonamido)-3-chloro-N-[2-(2-phenylethylcarbamoyl)phenyl]benzamide (PubChem CID 43915504) has the molecular formula C28H24ClN3O4S and a molecular weight of 534.04 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-3-chloro-N-[2-(2-phenylethylcarbamoyl)phenyl]benzamide.
| Compound Name | 4-(benzenesulfonamido)-3-chloro-N-[2-(2-phenylethylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 43915504 |
| Molecular Formula | C28H24ClN3O4S |
| Molecular Weight | 534.04 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | 4-(benzenesulfonamido)-3-chloro-N-[2-(2-phenylethylcarbamoyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1C(=O)NCCc1ccccc1)c1ccc(NS(=O)(=O)c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C28H24ClN3O4S/c29-24-19-21(15-16-26(24)32-37(35,36)22-11-5-2-6-12-22)27(33)31-25-14-8-7-13-23(25)28(34)30-18-17-20-9-3-1-4-10-20/h1-16,19,32H,17-18H2,(H,30,34)(H,31,33) |
| InChIKey | WEQYTDDWTONMJW-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.04 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |