C14H28NO2+ — CID 3282312
1,4-dioxaspiro[4.5]decan-3-ylmethyl-diethyl-methylazanium (PubChem CID 3282312) has the molecular formula C14H28NO2+ and a molecular weight of 242.38 g/mol. Its IUPAC name is 1,4-dioxaspiro[4.5]decan-3-ylmethyl-diethyl-methylazanium.
| Compound Name | 1,4-dioxaspiro[4.5]decan-3-ylmethyl-diethyl-methylazanium |
|---|---|
| PubChem CID | 3282312 |
| Molecular Formula | C14H28NO2+ |
| Molecular Weight | 242.38 g/mol |
| Exact Mass | 242.21 |
| IUPAC Name | 1,4-dioxaspiro[4.5]decan-3-ylmethyl-diethyl-methylazanium |
| SMILES | CC[N+](C)(CC)CC1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C14H28NO2/c1-4-15(3,5-2)11-13-12-16-14(17-13)9-7-6-8-10-14/h13H,4-12H2,1-3H3/q+1 |
| InChIKey | CUVTZZGROUKFNK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|