C18H24N4OS2 — CID 32836849
1-[[(1R,2R)-2-(1,3-benzothiazol-2-yl)cyclohexanecarbonyl]amino]-3-propan-2-ylthiourea (PubChem CID 32836849) has the molecular formula C18H24N4OS2 and a molecular weight of 376.55 g/mol. Its IUPAC name is 1-[[(1R,2R)-2-(1,3-benzothiazol-2-yl)cyclohexanecarbonyl]amino]-3-propan-2-ylthiourea.
| Compound Name | 1-[[(1R,2R)-2-(1,3-benzothiazol-2-yl)cyclohexanecarbonyl]amino]-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 32836849 |
| Molecular Formula | C18H24N4OS2 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 1-[[(1R,2R)-2-(1,3-benzothiazol-2-yl)cyclohexanecarbonyl]amino]-3-propan-2-ylthiourea |
| SMILES | CC(C)NC(=S)NNC(=O)[C@@H]1CCCC[C@H]1c1nc2ccccc2s1 |
| InChI | InChI=1S/C18H24N4OS2/c1-11(2)19-18(24)22-21-16(23)12-7-3-4-8-13(12)17-20-14-9-5-6-10-15(14)25-17/h5-6,9-13H,3-4,7-8H2,1-2H3,(H,21,23)(H2,19,22,24)/t12-,13-/m1/s1 |
| InChIKey | GWGCLBSMRWVSEN-CHWSQXEVSA-N |
| XLogP | 3.47 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|