C20H14IN3O2 — CID 3284479
2-cyano-N-(4-hydroxyphenyl)-3-[1-(4-iodophenyl)pyrrol-2-yl]prop-2-enamide (PubChem CID 3284479) has the molecular formula C20H14IN3O2 and a molecular weight of 455.26 g/mol. Its IUPAC name is 2-cyano-N-(4-hydroxyphenyl)-3-[1-(4-iodophenyl)pyrrol-2-yl]prop-2-enamide.
| Compound Name | 2-cyano-N-(4-hydroxyphenyl)-3-[1-(4-iodophenyl)pyrrol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3284479 |
| Molecular Formula | C20H14IN3O2 |
| Molecular Weight | 455.26 g/mol |
| Exact Mass | 455.01 |
| IUPAC Name | 2-cyano-N-(4-hydroxyphenyl)-3-[1-(4-iodophenyl)pyrrol-2-yl]prop-2-enamide |
| SMILES | N#CC(=Cc1cccn1-c1ccc(I)cc1)C(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C20H14IN3O2/c21-15-3-7-17(8-4-15)24-11-1-2-18(24)12-14(13-22)20(26)23-16-5-9-19(25)10-6-16/h1-12,25H,(H,23,26) |
| InChIKey | KZRBYWPEOLYIGT-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.26 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|