C21H19FN4O4 — CID 3285972
N-[2-[[1-[(4-fluorophenyl)methyl]-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]phenyl]propanamide (PubChem CID 3285972) has the molecular formula C21H19FN4O4 and a molecular weight of 410.41 g/mol. Its IUPAC name is N-[2-[[1-[(4-fluorophenyl)methyl]-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]phenyl]propanamide.
| Compound Name | N-[2-[[1-[(4-fluorophenyl)methyl]-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]phenyl]propanamide |
|---|---|
| PubChem CID | 3285972 |
| Molecular Formula | C21H19FN4O4 |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | N-[2-[[1-[(4-fluorophenyl)methyl]-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccccc1/N=C/c1c(O)n(Cc2ccc(F)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H19FN4O4/c1-2-18(27)24-17-6-4-3-5-16(17)23-11-15-19(28)25-21(30)26(20(15)29)12-13-7-9-14(22)10-8-13/h3-11,29H,2,12H2,1H3,(H,24,27)(H,25,28,30)/b23-11+ |
| InChIKey | QQCRJOSAKCEUIR-FOKLQQMPSA-N |
| XLogP | 2.53 |
| TPSA | 116.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|