C21H27N5O5S — CID 32861552
(2R)-2-[4-(4-nitrophenyl)piperazin-1-yl]-N-[(1S)-1-(4-sulfamoylphenyl)ethyl]propanamide (PubChem CID 32861552) has the molecular formula C21H27N5O5S and a molecular weight of 461.54 g/mol. Its IUPAC name is (2R)-2-[4-(4-nitrophenyl)piperazin-1-yl]-N-[(1S)-1-(4-sulfamoylphenyl)ethyl]propanamide.
| Compound Name | (2R)-2-[4-(4-nitrophenyl)piperazin-1-yl]-N-[(1S)-1-(4-sulfamoylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 32861552 |
| Molecular Formula | C21H27N5O5S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | (2R)-2-[4-(4-nitrophenyl)piperazin-1-yl]-N-[(1S)-1-(4-sulfamoylphenyl)ethyl]propanamide |
| SMILES | C[C@H](NC(=O)[C@@H](C)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C21H27N5O5S/c1-15(17-3-9-20(10-4-17)32(22,30)31)23-21(27)16(2)24-11-13-25(14-12-24)18-5-7-19(8-6-18)26(28)29/h3-10,15-16H,11-14H2,1-2H3,(H,23,27)(H2,22,30,31)/t15-,16+/m0/s1 |
| InChIKey | AJQRUCPHZDYOAY-JKSUJKDBSA-N |
| XLogP | 1.63 |
| TPSA | 138.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|