C17H28N4O3S — CID 120772528
2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-N-[1-(4-sulfamoylphenyl)ethyl]propanamide (PubChem CID 120772528) has the molecular formula C17H28N4O3S and a molecular weight of 368.50 g/mol. Its IUPAC name is 2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-N-[1-(4-sulfamoylphenyl)ethyl]propanamide.
| Compound Name | 2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-N-[1-(4-sulfamoylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 120772528 |
| Molecular Formula | C17H28N4O3S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-N-[1-(4-sulfamoylphenyl)ethyl]propanamide |
| SMILES | CC(NC(=O)C(C)N1CCC(C)(CN)C1)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C17H28N4O3S/c1-12(14-4-6-15(7-5-14)25(19,23)24)20-16(22)13(2)21-9-8-17(3,10-18)11-21/h4-7,12-13H,8-11,18H2,1-3H3,(H,20,22)(H2,19,23,24) |
| InChIKey | XUGPUQDJMDIJHI-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |