C10H8F3N2O2+ — CID 3288663
2-[2-(trifluoromethyl)-3H-benzimidazol-1-ium-1-yl]acetic acid (PubChem CID 3288663) has the molecular formula C10H8F3N2O2+ and a molecular weight of 245.18 g/mol. Its IUPAC name is 2-[2-(trifluoromethyl)-3H-benzimidazol-1-ium-1-yl]acetic acid.
| Compound Name | 2-[2-(trifluoromethyl)-3H-benzimidazol-1-ium-1-yl]acetic acid |
|---|---|
| PubChem CID | 3288663 |
| Molecular Formula | C10H8F3N2O2+ |
| Molecular Weight | 245.18 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 2-[2-(trifluoromethyl)-3H-benzimidazol-1-ium-1-yl]acetic acid |
| SMILES | O=C(O)C[n+]1c(C(F)(F)F)[nH]c2ccccc21 |
| InChI | InChI=1S/C10H7F3N2O2/c11-10(12,13)9-14-6-3-1-2-4-7(6)15(9)5-8(16)17/h1-4H,5H2,(H,16,17)/p+1 |
| InChIKey | GPOYZFXQCCJBTF-UHFFFAOYSA-O |
| XLogP | 1.56 |
| TPSA | 56.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.18 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|