About (2-fluorophenyl)methyl 4-(acetamidomethyl)benzoate
(2-fluorophenyl)methyl 4-(acetamidomethyl)benzoate (PubChem CID 32887884) has the molecular formula C17H16FNO3
and a molecular weight of 301.32 g/mol. Its IUPAC name is (2-fluorophenyl)methyl 4-(acetamidomethyl)benzoate.
Molecular Properties
| Compound Name | (2-fluorophenyl)methyl 4-(acetamidomethyl)benzoate |
| PubChem CID | 32887884 |
| Molecular Formula | C17H16FNO3 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | (2-fluorophenyl)methyl 4-(acetamidomethyl)benzoate |
| SMILES | CC(=O)NCc1ccc(C(=O)OCc2ccccc2F)cc1 |
| InChI | InChI=1S/C17H16FNO3/c1-12(20)19-10-13-6-8-14(9-7-13)17(21)22-11-15-4-2-3-5-16(15)18/h2-9H,10-11H2,1H3,(H,19,20) |
| InChIKey | DWXQVMWXWOXOQZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-fluorophenyl)methyl 4-(acetamidomethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluorophenyl)methyl 4-(acetamidomethyl)benzoate?
The IUPAC name of (2-fluorophenyl)methyl 4-(acetamidomethyl)benzoate (CID 32887884) is (2-fluorophenyl)methyl 4-(acetamidomethyl)benzoate.
What is the SMILES notation for (2-fluorophenyl)methyl 4-(acetamidomethyl)benzoate?
The canonical SMILES for (2-fluorophenyl)methyl 4-(acetamidomethyl)benzoate is CC(=O)NCc1ccc(C(=O)OCc2ccccc2F)cc1.
What is the InChIKey of (2-fluorophenyl)methyl 4-(acetamidomethyl)benzoate?
The InChIKey is DWXQVMWXWOXOQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16FNO3/c1-12(20)19-10-13-6-8-14(9-7-13)17(21)22-11-15-4-2-3-5-16(15)18/h2-9H,10-11H2,1H3,(H,19,20).
What are the key properties of (2-fluorophenyl)methyl 4-(acetamidomethyl)benzoate?
(2-fluorophenyl)methyl 4-(acetamidomethyl)benzoate has a molecular weight of 301.32 g/mol, XLogP of 2.82, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluorophenyl)methyl 4-(acetamidomethyl)benzoate is sourced from PubChem (CID 32887884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).