C21H25Br2N3O — CID 3289087
2,4-dibromo-6-[[(3-heptyl-1H-benzimidazol-3-ium-2-yl)amino]methyl]phenolate (PubChem CID 3289087) has the molecular formula C21H25Br2N3O and a molecular weight of 495.26 g/mol. Its IUPAC name is 2,4-dibromo-6-[[(3-heptyl-1H-benzimidazol-3-ium-2-yl)amino]methyl]phenolate.
| Compound Name | 2,4-dibromo-6-[[(3-heptyl-1H-benzimidazol-3-ium-2-yl)amino]methyl]phenolate |
|---|---|
| PubChem CID | 3289087 |
| Molecular Formula | C21H25Br2N3O |
| Molecular Weight | 495.26 g/mol |
| Exact Mass | 493.04 |
| IUPAC Name | 2,4-dibromo-6-[[(3-heptyl-1H-benzimidazol-3-ium-2-yl)amino]methyl]phenolate |
| SMILES | CCCCCCC[n+]1c(NCc2cc(Br)cc(Br)c2[O-])[nH]c2ccccc21 |
| InChI | InChI=1S/C21H25Br2N3O/c1-2-3-4-5-8-11-26-19-10-7-6-9-18(19)25-21(26)24-14-15-12-16(22)13-17(23)20(15)27/h6-7,9-10,12-13H,2-5,8,11,14H2,1H3,(H2,24,25,27) |
| InChIKey | RWPRKTNGSQBFCN-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 54.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.26 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|