2-(6-pyridin-3-ylimidazo[2,1-b][1,3]thiazol-2-yl)acetic acid

C12H9N3O2S — CID 3290134

IUPAC2-(6-pyridin-3-ylimidazo[2,1-b][1,3]thiazol-2-yl)acetic acid
SMILESO=C(O)Cc1cn2cc(-c3cccnc3)nc2s1
InChIInChI=1S/C12H9N3O2S/c16-11(17)4-9-6-15-7-10(14-12(15)18-9)8-2-1-3-13-5-8/h1-3,5-7H,4H2,(H,16,17)
InChIKeyAMTHZBBTGBJFAF-UHFFFAOYSA-N
MW259.29 g/mol
LogP2.08
Rot. Bonds3

About 2-(6-pyridin-3-ylimidazo[2,1-b][1,3]thiazol-2-yl)acetic acid

2-(6-pyridin-3-ylimidazo[2,1-b][1,3]thiazol-2-yl)acetic acid (PubChem CID 3290134) has the molecular formula C12H9N3O2S and a molecular weight of 259.29 g/mol. Its IUPAC name is 2-(6-pyridin-3-ylimidazo[2,1-b][1,3]thiazol-2-yl)acetic acid.

Molecular Properties

Compound Name2-(6-pyridin-3-ylimidazo[2,1-b][1,3]thiazol-2-yl)acetic acid
PubChem CID3290134
Molecular FormulaC12H9N3O2S
Molecular Weight259.29 g/mol
Exact Mass259.04
IUPAC Name2-(6-pyridin-3-ylimidazo[2,1-b][1,3]thiazol-2-yl)acetic acid
SMILESO=C(O)Cc1cn2cc(-c3cccnc3)nc2s1
InChIInChI=1S/C12H9N3O2S/c16-11(17)4-9-6-15-7-10(14-12(15)18-9)8-2-1-3-13-5-8/h1-3,5-7H,4H2,(H,16,17)
InChIKeyAMTHZBBTGBJFAF-UHFFFAOYSA-N
XLogP2.08
TPSA67.49 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.29
LogP ≤ 52.08
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-(6-pyridin-3-ylimidazo[2,1-b][1,3]thiazol-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6-pyridin-3-ylimidazo[2,1-b][1,3]thiazol-2-yl)acetic acid?
The IUPAC name of 2-(6-pyridin-3-ylimidazo[2,1-b][1,3]thiazol-2-yl)acetic acid (CID 3290134) is 2-(6-pyridin-3-ylimidazo[2,1-b][1,3]thiazol-2-yl)acetic acid.
What is the SMILES notation for 2-(6-pyridin-3-ylimidazo[2,1-b][1,3]thiazol-2-yl)acetic acid?
The canonical SMILES for 2-(6-pyridin-3-ylimidazo[2,1-b][1,3]thiazol-2-yl)acetic acid is O=C(O)Cc1cn2cc(-c3cccnc3)nc2s1.
What is the InChIKey of 2-(6-pyridin-3-ylimidazo[2,1-b][1,3]thiazol-2-yl)acetic acid?
The InChIKey is AMTHZBBTGBJFAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3O2S/c16-11(17)4-9-6-15-7-10(14-12(15)18-9)8-2-1-3-13-5-8/h1-3,5-7H,4H2,(H,16,17).
What are the key properties of 2-(6-pyridin-3-ylimidazo[2,1-b][1,3]thiazol-2-yl)acetic acid?
2-(6-pyridin-3-ylimidazo[2,1-b][1,3]thiazol-2-yl)acetic acid has a molecular weight of 259.29 g/mol, XLogP of 2.08, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-pyridin-3-ylimidazo[2,1-b][1,3]thiazol-2-yl)acetic acid is sourced from PubChem (CID 3290134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).