C21H22FN5O2S2 — CID 3291304
N'-[2-[[4-cyclohexyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]thiophene-2-carbohydrazide (PubChem CID 3291304) has the molecular formula C21H22FN5O2S2 and a molecular weight of 459.57 g/mol. Its IUPAC name is N'-[2-[[4-cyclohexyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]thiophene-2-carbohydrazide.
| Compound Name | N'-[2-[[4-cyclohexyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 3291304 |
| Molecular Formula | C21H22FN5O2S2 |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | N'-[2-[[4-cyclohexyl-5-(2-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]thiophene-2-carbohydrazide |
| SMILES | O=C(CSc1nnc(-c2ccccc2F)n1C1CCCCC1)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C21H22FN5O2S2/c22-16-10-5-4-9-15(16)19-24-26-21(27(19)14-7-2-1-3-8-14)31-13-18(28)23-25-20(29)17-11-6-12-30-17/h4-6,9-12,14H,1-3,7-8,13H2,(H,23,28)(H,25,29) |
| InChIKey | SVYGEPDVWHEOPJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|