C12H10N4O2S — CID 3291456
1-phenyl-3-(1H-1,2,4-triazol-5-ylsulfanyl)pyrrolidine-2,5-dione (PubChem CID 3291456) has the molecular formula C12H10N4O2S and a molecular weight of 274.31 g/mol. Its IUPAC name is 1-phenyl-3-(1H-1,2,4-triazol-5-ylsulfanyl)pyrrolidine-2,5-dione.
| Compound Name | 1-phenyl-3-(1H-1,2,4-triazol-5-ylsulfanyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 3291456 |
| Molecular Formula | C12H10N4O2S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 1-phenyl-3-(1H-1,2,4-triazol-5-ylsulfanyl)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(Sc2ncn[nH]2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C12H10N4O2S/c17-10-6-9(19-12-13-7-14-15-12)11(18)16(10)8-4-2-1-3-5-8/h1-5,7,9H,6H2,(H,13,14,15) |
| InChIKey | VLSAMKRKIRBAKL-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|