C22H20NO4- — CID 3292522
10-(1,3-benzodioxol-5-yl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-7-carboxylate (PubChem CID 3292522) has the molecular formula C22H20NO4- and a molecular weight of 362.41 g/mol. Its IUPAC name is 10-(1,3-benzodioxol-5-yl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-7-carboxylate.
| Compound Name | 10-(1,3-benzodioxol-5-yl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-7-carboxylate |
|---|---|
| PubChem CID | 3292522 |
| Molecular Formula | C22H20NO4- |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 10-(1,3-benzodioxol-5-yl)-9-azatetracyclo[10.2.1.02,11.03,8]pentadeca-3(8),4,6-triene-7-carboxylate |
| SMILES | O=C([O-])c1cccc2c1NC(c1ccc3c(c1)OCO3)C1C3CCC(C3)C21 |
| InChI | InChI=1S/C22H21NO4/c24-22(25)15-3-1-2-14-18-11-4-5-12(8-11)19(18)20(23-21(14)15)13-6-7-16-17(9-13)27-10-26-16/h1-3,6-7,9,11-12,18-20,23H,4-5,8,10H2,(H,24,25)/p-1 |
| InChIKey | MGPKBCRGXMGOLA-UHFFFAOYSA-M |
| XLogP | 3.08 |
| TPSA | 70.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |