C22H26ClN5O5 — CID 3292870
(2-chloro-3,4-dimethoxyphenyl)-[4-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)-1,2,4-oxadiazol-3-yl]methyl]-1,4-diazepan-1-yl]methanone (PubChem CID 3292870) has the molecular formula C22H26ClN5O5 and a molecular weight of 475.93 g/mol. Its IUPAC name is (2-chloro-3,4-dimethoxyphenyl)-[4-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)-1,2,4-oxadiazol-3-yl]methyl]-1,4-diazepan-1-yl]methanone.
| Compound Name | (2-chloro-3,4-dimethoxyphenyl)-[4-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)-1,2,4-oxadiazol-3-yl]methyl]-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 3292870 |
| Molecular Formula | C22H26ClN5O5 |
| Molecular Weight | 475.93 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | (2-chloro-3,4-dimethoxyphenyl)-[4-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)-1,2,4-oxadiazol-3-yl]methyl]-1,4-diazepan-1-yl]methanone |
| SMILES | COc1ccc(C(=O)N2CCCN(Cc3noc(-c4c(C)noc4C)n3)CC2)c(Cl)c1OC |
| InChI | InChI=1S/C22H26ClN5O5/c1-13-18(14(2)32-25-13)21-24-17(26-33-21)12-27-8-5-9-28(11-10-27)22(29)15-6-7-16(30-3)20(31-4)19(15)23/h6-7H,5,8-12H2,1-4H3 |
| InChIKey | UNCABCQINOFTRL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 106.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.93 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |