C23H27N5O5S — CID 74224146
1-[4-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)-1,2,4-oxadiazol-3-yl]methyl]-1,4-diazepan-1-yl]-2-[(E)-2-phenylethenyl]sulfonylethanone (PubChem CID 74224146) has the molecular formula C23H27N5O5S and a molecular weight of 485.57 g/mol. Its IUPAC name is 1-[4-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)-1,2,4-oxadiazol-3-yl]methyl]-1,4-diazepan-1-yl]-2-[(E)-2-phenylethenyl]sulfonylethanone.
| Compound Name | 1-[4-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)-1,2,4-oxadiazol-3-yl]methyl]-1,4-diazepan-1-yl]-2-[(E)-2-phenylethenyl]sulfonylethanone |
|---|---|
| PubChem CID | 74224146 |
| Molecular Formula | C23H27N5O5S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 1-[4-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)-1,2,4-oxadiazol-3-yl]methyl]-1,4-diazepan-1-yl]-2-[(E)-2-phenylethenyl]sulfonylethanone |
| SMILES | Cc1noc(C)c1-c1nc(CN2CCCN(C(=O)CS(=O)(=O)/C=C/c3ccccc3)CC2)no1 |
| InChI | InChI=1S/C23H27N5O5S/c1-17-22(18(2)32-25-17)23-24-20(26-33-23)15-27-10-6-11-28(13-12-27)21(29)16-34(30,31)14-9-19-7-4-3-5-8-19/h3-5,7-9,14H,6,10-13,15-16H2,1-2H3/b14-9+ |
| InChIKey | CSYISZYTIOECDD-NTEUORMPSA-N |
| XLogP | 2.46 |
| TPSA | 122.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |