C10H9F4N5O4 — CID 3292934
1-[3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-2-(3-nitropyrazol-1-yl)ethanone (PubChem CID 3292934) has the molecular formula C10H9F4N5O4 and a molecular weight of 339.21 g/mol. Its IUPAC name is 1-[3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-2-(3-nitropyrazol-1-yl)ethanone.
| Compound Name | 1-[3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-2-(3-nitropyrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 3292934 |
| Molecular Formula | C10H9F4N5O4 |
| Molecular Weight | 339.21 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 1-[3,5-bis(difluoromethyl)-5-hydroxy-4H-pyrazol-1-yl]-2-(3-nitropyrazol-1-yl)ethanone |
| SMILES | O=C(Cn1ccc([N+](=O)[O-])n1)N1N=C(C(F)F)CC1(O)C(F)F |
| InChI | InChI=1S/C10H9F4N5O4/c11-8(12)5-3-10(21,9(13)14)18(15-5)7(20)4-17-2-1-6(16-17)19(22)23/h1-2,8-9,21H,3-4H2 |
| InChIKey | BPXHKXKJVZETDU-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 113.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.21 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|