C10H10F3N5O4 — CID 5143772
1-[5-hydroxy-3-methyl-5-(trifluoromethyl)-4H-pyrazol-1-yl]-2-(3-nitropyrazol-1-yl)ethanone (PubChem CID 5143772) has the molecular formula C10H10F3N5O4 and a molecular weight of 321.22 g/mol. Its IUPAC name is 1-[5-hydroxy-3-methyl-5-(trifluoromethyl)-4H-pyrazol-1-yl]-2-(3-nitropyrazol-1-yl)ethanone.
| Compound Name | 1-[5-hydroxy-3-methyl-5-(trifluoromethyl)-4H-pyrazol-1-yl]-2-(3-nitropyrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 5143772 |
| Molecular Formula | C10H10F3N5O4 |
| Molecular Weight | 321.22 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 1-[5-hydroxy-3-methyl-5-(trifluoromethyl)-4H-pyrazol-1-yl]-2-(3-nitropyrazol-1-yl)ethanone |
| SMILES | CC1=NN(C(=O)Cn2ccc([N+](=O)[O-])n2)C(O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C10H10F3N5O4/c1-6-4-9(20,10(11,12)13)17(14-6)8(19)5-16-3-2-7(15-16)18(21)22/h2-3,20H,4-5H2,1H3 |
| InChIKey | CKBFQIWITZJUFB-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 113.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.22 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|