C22H22N2O4S2 — CID 32935559
3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)-N-(2-phenoxyethyl)benzamide (PubChem CID 32935559) has the molecular formula C22H22N2O4S2 and a molecular weight of 442.56 g/mol. Its IUPAC name is 3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)-N-(2-phenoxyethyl)benzamide.
| Compound Name | 3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)-N-(2-phenoxyethyl)benzamide |
|---|---|
| PubChem CID | 32935559 |
| Molecular Formula | C22H22N2O4S2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)-N-(2-phenoxyethyl)benzamide |
| SMILES | O=C(NCCOc1ccccc1)c1cccc(S(=O)(=O)N2CCc3sccc3C2)c1 |
| InChI | InChI=1S/C22H22N2O4S2/c25-22(23-11-13-28-19-6-2-1-3-7-19)17-5-4-8-20(15-17)30(26,27)24-12-9-21-18(16-24)10-14-29-21/h1-8,10,14-15H,9,11-13,16H2,(H,23,25) |
| InChIKey | PMXZTHIUBDHYER-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|