C17H22ClN3O3S2 — CID 119408776
N-(3-aminopropyl)-3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)benzamide;hydrochloride (PubChem CID 119408776) has the molecular formula C17H22ClN3O3S2 and a molecular weight of 415.97 g/mol. Its IUPAC name is N-(3-aminopropyl)-3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)benzamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119408776 |
| Molecular Formula | C17H22ClN3O3S2 |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | N-(3-aminopropyl)-3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)benzamide;hydrochloride |
| SMILES | Cl.NCCCNC(=O)c1cccc(S(=O)(=O)N2CCc3sccc3C2)c1 |
| InChI | InChI=1S/C17H21N3O3S2.ClH/c18-7-2-8-19-17(21)13-3-1-4-15(11-13)25(22,23)20-9-5-16-14(12-20)6-10-24-16;/h1,3-4,6,10-11H,2,5,7-9,12,18H2,(H,19,21);1H |
| InChIKey | PVAPBHKDJZLMJR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|