C21H19N3O6S2 — CID 46577696
3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)-N-[(2-hydroxy-5-nitrophenyl)methyl]benzamide (PubChem CID 46577696) has the molecular formula C21H19N3O6S2 and a molecular weight of 473.53 g/mol. Its IUPAC name is 3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)-N-[(2-hydroxy-5-nitrophenyl)methyl]benzamide.
| Compound Name | 3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)-N-[(2-hydroxy-5-nitrophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 46577696 |
| Molecular Formula | C21H19N3O6S2 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | 3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)-N-[(2-hydroxy-5-nitrophenyl)methyl]benzamide |
| SMILES | O=C(NCc1cc([N+](=O)[O-])ccc1O)c1cccc(S(=O)(=O)N2CCc3sccc3C2)c1 |
| InChI | InChI=1S/C21H19N3O6S2/c25-19-5-4-17(24(27)28)10-16(19)12-22-21(26)14-2-1-3-18(11-14)32(29,30)23-8-6-20-15(13-23)7-9-31-20/h1-5,7,9-11,25H,6,8,12-13H2,(H,22,26) |
| InChIKey | PJSKHWIDEFCESX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|