C42H41ClFN3O7 — CID 3294632
6a-(4-chlorophenyl)-2-cyclohexyl-8-(4-fluoroanilino)-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3294632) has the molecular formula C42H41ClFN3O7 and a molecular weight of 754.26 g/mol. Its IUPAC name is 6a-(4-chlorophenyl)-2-cyclohexyl-8-(4-fluoroanilino)-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6a-(4-chlorophenyl)-2-cyclohexyl-8-(4-fluoroanilino)-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3294632 |
| Molecular Formula | C42H41ClFN3O7 |
| Molecular Weight | 754.26 g/mol |
| Exact Mass | 753.26 |
| IUPAC Name | 6a-(4-chlorophenyl)-2-cyclohexyl-8-(4-fluoroanilino)-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(C=CC2C3=CCC4C(=O)N(C5CCCCC5)C(=O)C4C3CC3C(=O)N(Nc4ccc(F)cc4)C(=O)C23c2ccc(Cl)cc2)cc(OC)c1O |
| InChI | InChI=1S/C42H41ClFN3O7/c1-53-34-20-23(21-35(54-2)37(34)48)8-19-32-29-17-18-30-36(40(51)46(38(30)49)28-6-4-3-5-7-28)31(29)22-33-39(50)47(45-27-15-13-26(44)14-16-27)41(52)42(32,33)24-9-11-25(43)12-10-24/h8-17,19-21,28,30-33,36,45,48H,3-7,18,22H2,1-2H3 |
| InChIKey | YMFDKKBBMMVLKP-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.26 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|