C22H24N4O3 — CID 3294656
N-butan-2-yl-1-(2,5-dimethylphenyl)-3-(4-nitrophenyl)pyrazole-5-carboxamide (PubChem CID 3294656) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is N-butan-2-yl-1-(2,5-dimethylphenyl)-3-(4-nitrophenyl)pyrazole-5-carboxamide.
| Compound Name | N-butan-2-yl-1-(2,5-dimethylphenyl)-3-(4-nitrophenyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 3294656 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | N-butan-2-yl-1-(2,5-dimethylphenyl)-3-(4-nitrophenyl)pyrazole-5-carboxamide |
| SMILES | CCC(C)NC(=O)c1cc(-c2ccc([N+](=O)[O-])cc2)nn1-c1cc(C)ccc1C |
| InChI | InChI=1S/C22H24N4O3/c1-5-16(4)23-22(27)21-13-19(17-8-10-18(11-9-17)26(28)29)24-25(21)20-12-14(2)6-7-15(20)3/h6-13,16H,5H2,1-4H3,(H,23,27) |
| InChIKey | PWUZRCPBKMEUFY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|