C35H33N5O3 — CID 5097283
(4-benzhydrylpiperazin-1-yl)-[1-(2,5-dimethylphenyl)-3-(4-nitrophenyl)pyrazol-5-yl]methanone (PubChem CID 5097283) has the molecular formula C35H33N5O3 and a molecular weight of 571.68 g/mol. Its IUPAC name is (4-benzhydrylpiperazin-1-yl)-[1-(2,5-dimethylphenyl)-3-(4-nitrophenyl)pyrazol-5-yl]methanone.
| Compound Name | (4-benzhydrylpiperazin-1-yl)-[1-(2,5-dimethylphenyl)-3-(4-nitrophenyl)pyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 5097283 |
| Molecular Formula | C35H33N5O3 |
| Molecular Weight | 571.68 g/mol |
| Exact Mass | 571.26 |
| IUPAC Name | (4-benzhydrylpiperazin-1-yl)-[1-(2,5-dimethylphenyl)-3-(4-nitrophenyl)pyrazol-5-yl]methanone |
| SMILES | Cc1ccc(C)c(-n2nc(-c3ccc([N+](=O)[O-])cc3)cc2C(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C35H33N5O3/c1-25-13-14-26(2)32(23-25)39-33(24-31(36-39)27-15-17-30(18-16-27)40(42)43)35(41)38-21-19-37(20-22-38)34(28-9-5-3-6-10-28)29-11-7-4-8-12-29/h3-18,23-24,34H,19-22H2,1-2H3 |
| InChIKey | NITPEQDEHWUPGW-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.68 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|