C31H27N3O — CID 42754685
N-benzhydryl-1-(2,5-dimethylphenyl)-3-phenylpyrazole-5-carboxamide (PubChem CID 42754685) has the molecular formula C31H27N3O and a molecular weight of 457.58 g/mol. Its IUPAC name is N-benzhydryl-1-(2,5-dimethylphenyl)-3-phenylpyrazole-5-carboxamide.
| Compound Name | N-benzhydryl-1-(2,5-dimethylphenyl)-3-phenylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 42754685 |
| Molecular Formula | C31H27N3O |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | N-benzhydryl-1-(2,5-dimethylphenyl)-3-phenylpyrazole-5-carboxamide |
| SMILES | Cc1ccc(C)c(-n2nc(-c3ccccc3)cc2C(=O)NC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C31H27N3O/c1-22-18-19-23(2)28(20-22)34-29(21-27(33-34)24-12-6-3-7-13-24)31(35)32-30(25-14-8-4-9-15-25)26-16-10-5-11-17-26/h3-21,30H,1-2H3,(H,32,35) |
| InChIKey | RQVKIHURJVSWLF-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |