C31H42O12 — CID 3295634
[1,3,11-triacetyloxy-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-10-yl]methyl acetate (PubChem CID 3295634) has the molecular formula C31H42O12 and a molecular weight of 606.67 g/mol. Its IUPAC name is [1,3,11-triacetyloxy-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-10-yl]methyl acetate.
| Compound Name | [1,3,11-triacetyloxy-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-10-yl]methyl acetate |
|---|---|
| PubChem CID | 3295634 |
| Molecular Formula | C31H42O12 |
| Molecular Weight | 606.67 g/mol |
| Exact Mass | 606.27 |
| IUPAC Name | [1,3,11-triacetyloxy-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-10-yl]methyl acetate |
| SMILES | CC(=O)OCC12C(OC(C)=O)CC(OC(C)=O)CC1(O)CCC1C2C(OC(C)=O)CC2(C)C(C3=CC(=O)OC3)CCC12O |
| InChI | InChI=1S/C31H42O12/c1-16(32)40-15-30-25(43-19(4)35)11-21(41-17(2)33)12-29(30,37)8-6-23-27(30)24(42-18(3)34)13-28(5)22(7-9-31(23,28)38)20-10-26(36)39-14-20/h10,21-25,27,37-38H,6-9,11-15H2,1-5H3 |
| InChIKey | LWEDMLOAXCZSBB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 171.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.67 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|