C30H44O12 — CID 45044760
ethyl (1S,11R)-1,3,11-triacetyloxy-10-(acetyloxymethyl)-5,14-dihydroxy-13-methyl-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 45044760) has the molecular formula C30H44O12 and a molecular weight of 596.67 g/mol. Its IUPAC name is ethyl (1S,11R)-1,3,11-triacetyloxy-10-(acetyloxymethyl)-5,14-dihydroxy-13-methyl-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | ethyl (1S,11R)-1,3,11-triacetyloxy-10-(acetyloxymethyl)-5,14-dihydroxy-13-methyl-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 45044760 |
| Molecular Formula | C30H44O12 |
| Molecular Weight | 596.67 g/mol |
| Exact Mass | 596.28 |
| IUPAC Name | ethyl (1S,11R)-1,3,11-triacetyloxy-10-(acetyloxymethyl)-5,14-dihydroxy-13-methyl-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | CCOC(=O)C1CCC2(O)C3CCC4(O)CC(OC(C)=O)C[C@H](OC(C)=O)C4(COC(C)=O)C3C(OC(C)=O)CC12C |
| InChI | InChI=1S/C30H44O12/c1-7-38-26(35)22-9-11-30(37)21-8-10-28(36)13-20(40-17(3)32)12-24(42-19(5)34)29(28,15-39-16(2)31)25(21)23(41-18(4)33)14-27(22,30)6/h20-25,36-37H,7-15H2,1-6H3/t20?,21?,22?,23?,24-,25?,27?,28?,29?,30?/m0/s1 |
| InChIKey | AMRMTJOEQNHFBE-GOQJOAIYSA-N |
| XLogP | 2.00 |
| TPSA | 171.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.67 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|