C26H36O9 — CID 125031140
ethyl (5S,8R,9S,10R,11R,13R,14S,17R)-11-acetyloxy-10-(acetyloxymethyl)-5,14-dihydroxy-13-methyl-3-oxo-4,6,7,8,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 125031140) has the molecular formula C26H36O9 and a molecular weight of 492.57 g/mol. Its IUPAC name is ethyl (5S,8R,9S,10R,11R,13R,14S,17R)-11-acetyloxy-10-(acetyloxymethyl)-5,14-dihydroxy-13-methyl-3-oxo-4,6,7,8,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | ethyl (5S,8R,9S,10R,11R,13R,14S,17R)-11-acetyloxy-10-(acetyloxymethyl)-5,14-dihydroxy-13-methyl-3-oxo-4,6,7,8,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 125031140 |
| Molecular Formula | C26H36O9 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | ethyl (5S,8R,9S,10R,11R,13R,14S,17R)-11-acetyloxy-10-(acetyloxymethyl)-5,14-dihydroxy-13-methyl-3-oxo-4,6,7,8,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC[C@]2(O)[C@@H]3CC[C@]4(O)CC(=O)C=C[C@]4(COC(C)=O)[C@H]3[C@H](OC(C)=O)C[C@]12C |
| InChI | InChI=1S/C26H36O9/c1-5-33-22(30)19-8-11-26(32)18-7-10-25(31)12-17(29)6-9-24(25,14-34-15(2)27)21(18)20(35-16(3)28)13-23(19,26)4/h6,9,18-21,31-32H,5,7-8,10-14H2,1-4H3/t18-,19+,20-,21-,23-,24+,25+,26+/m1/s1 |
| InChIKey | MBWSSSGISWBMMZ-FLJPAJCISA-N |
| XLogP | 1.87 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|