C25H38O8 — CID 124913460
ethyl (1R,2R,3S,5S,6R,9S,10S,13R,17S)-3,9,13-trihydroxy-5,19,19-trimethyl-15-oxo-18,20-dioxapentacyclo[11.8.0.01,17.02,10.05,9]henicosane-6-carboxylate (PubChem CID 124913460) has the molecular formula C25H38O8 and a molecular weight of 466.57 g/mol. Its IUPAC name is ethyl (1R,2R,3S,5S,6R,9S,10S,13R,17S)-3,9,13-trihydroxy-5,19,19-trimethyl-15-oxo-18,20-dioxapentacyclo[11.8.0.01,17.02,10.05,9]henicosane-6-carboxylate.
| Compound Name | ethyl (1R,2R,3S,5S,6R,9S,10S,13R,17S)-3,9,13-trihydroxy-5,19,19-trimethyl-15-oxo-18,20-dioxapentacyclo[11.8.0.01,17.02,10.05,9]henicosane-6-carboxylate |
|---|---|
| PubChem CID | 124913460 |
| Molecular Formula | C25H38O8 |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | ethyl (1R,2R,3S,5S,6R,9S,10S,13R,17S)-3,9,13-trihydroxy-5,19,19-trimethyl-15-oxo-18,20-dioxapentacyclo[11.8.0.01,17.02,10.05,9]henicosane-6-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC[C@]2(O)[C@H]3CC[C@@]4(O)CC(=O)C[C@@H]5OC(C)(C)OC[C@]54[C@@H]3[C@@H](O)C[C@@]12C |
| InChI | InChI=1S/C25H38O8/c1-5-31-20(28)16-7-9-25(30)15-6-8-23(29)11-14(26)10-18-24(23,13-32-21(2,3)33-18)19(15)17(27)12-22(16,25)4/h15-19,27,29-30H,5-13H2,1-4H3/t15-,16-,17-,18-,19-,22-,23+,24+,25-/m0/s1 |
| InChIKey | OGGZMHPAAAAXHP-OVXDTRQGSA-N |
| XLogP | 1.72 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |