C25H40O8 — CID 125032613
ethyl (1S,2R,3R,5R,6R,9S,10R,13S,15R,17S)-3,9,13,15-tetrahydroxy-5,19,19-trimethyl-18,20-dioxapentacyclo[11.8.0.01,17.02,10.05,9]henicosane-6-carboxylate (PubChem CID 125032613) has the molecular formula C25H40O8 and a molecular weight of 468.59 g/mol. Its IUPAC name is ethyl (1S,2R,3R,5R,6R,9S,10R,13S,15R,17S)-3,9,13,15-tetrahydroxy-5,19,19-trimethyl-18,20-dioxapentacyclo[11.8.0.01,17.02,10.05,9]henicosane-6-carboxylate.
| Compound Name | ethyl (1S,2R,3R,5R,6R,9S,10R,13S,15R,17S)-3,9,13,15-tetrahydroxy-5,19,19-trimethyl-18,20-dioxapentacyclo[11.8.0.01,17.02,10.05,9]henicosane-6-carboxylate |
|---|---|
| PubChem CID | 125032613 |
| Molecular Formula | C25H40O8 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | ethyl (1S,2R,3R,5R,6R,9S,10R,13S,15R,17S)-3,9,13,15-tetrahydroxy-5,19,19-trimethyl-18,20-dioxapentacyclo[11.8.0.01,17.02,10.05,9]henicosane-6-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC[C@]2(O)[C@@H]3CC[C@]4(O)C[C@H](O)C[C@@H]5OC(C)(C)OC[C@@]54[C@@H]3[C@H](O)C[C@]12C |
| InChI | InChI=1S/C25H40O8/c1-5-31-20(28)16-7-9-25(30)15-6-8-23(29)11-14(26)10-18-24(23,13-32-21(2,3)33-18)19(15)17(27)12-22(16,25)4/h14-19,26-27,29-30H,5-13H2,1-4H3/t14-,15-,16+,17-,18+,19+,22-,23+,24+,25+/m1/s1 |
| InChIKey | YYQHRUMBJYAHKE-BIXXAHSSSA-N |
| XLogP | 1.51 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |