C17H22N2O2S — CID 32967722
3-[[(2S)-oxolan-2-yl]methyl]spiro[1H-quinazoline-2,4'-thiane]-4-one (PubChem CID 32967722) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is 3-[[(2S)-oxolan-2-yl]methyl]spiro[1H-quinazoline-2,4'-thiane]-4-one.
| Compound Name | 3-[[(2S)-oxolan-2-yl]methyl]spiro[1H-quinazoline-2,4'-thiane]-4-one |
|---|---|
| PubChem CID | 32967722 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 3-[[(2S)-oxolan-2-yl]methyl]spiro[1H-quinazoline-2,4'-thiane]-4-one |
| SMILES | O=C1c2ccccc2NC2(CCSCC2)N1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C17H22N2O2S/c20-16-14-5-1-2-6-15(14)18-17(7-10-22-11-8-17)19(16)12-13-4-3-9-21-13/h1-2,5-6,13,18H,3-4,7-12H2/t13-/m0/s1 |
| InChIKey | DNLPSFIELXALJR-ZDUSSCGKSA-N |
| XLogP | 2.96 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |