C23H26N2O3 — CID 54780423
2-methyl-3-(oxolan-2-ylmethyl)-2-(2-prop-2-enoxyphenyl)-1H-quinazolin-4-one (PubChem CID 54780423) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is 2-methyl-3-(oxolan-2-ylmethyl)-2-(2-prop-2-enoxyphenyl)-1H-quinazolin-4-one.
| Compound Name | 2-methyl-3-(oxolan-2-ylmethyl)-2-(2-prop-2-enoxyphenyl)-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 54780423 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 2-methyl-3-(oxolan-2-ylmethyl)-2-(2-prop-2-enoxyphenyl)-1H-quinazolin-4-one |
| SMILES | C=CCOc1ccccc1C1(C)Nc2ccccc2C(=O)N1CC1CCCO1 |
| InChI | InChI=1S/C23H26N2O3/c1-3-14-28-21-13-7-5-11-19(21)23(2)24-20-12-6-4-10-18(20)22(26)25(23)16-17-9-8-15-27-17/h3-7,10-13,17,24H,1,8-9,14-16H2,2H3 |
| InChIKey | HHVMQNZMLLTDSG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|