C24H30N2O3 — CID 54779127
3-butan-2-yl-2-methyl-2-[2-(oxolan-2-ylmethoxy)phenyl]-1H-quinazolin-4-one (PubChem CID 54779127) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is 3-butan-2-yl-2-methyl-2-[2-(oxolan-2-ylmethoxy)phenyl]-1H-quinazolin-4-one.
| Compound Name | 3-butan-2-yl-2-methyl-2-[2-(oxolan-2-ylmethoxy)phenyl]-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 54779127 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 3-butan-2-yl-2-methyl-2-[2-(oxolan-2-ylmethoxy)phenyl]-1H-quinazolin-4-one |
| SMILES | CCC(C)N1C(=O)c2ccccc2NC1(C)c1ccccc1OCC1CCCO1 |
| InChI | InChI=1S/C24H30N2O3/c1-4-17(2)26-23(27)19-11-5-7-13-21(19)25-24(26,3)20-12-6-8-14-22(20)29-16-18-10-9-15-28-18/h5-8,11-14,17-18,25H,4,9-10,15-16H2,1-3H3 |
| InChIKey | JCSLYMGWFRYJNY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |