C25H32N2O3 — CID 54779143
3-butan-2-yl-2-ethyl-2-[4-(oxolan-2-ylmethoxy)phenyl]-1H-quinazolin-4-one (PubChem CID 54779143) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is 3-butan-2-yl-2-ethyl-2-[4-(oxolan-2-ylmethoxy)phenyl]-1H-quinazolin-4-one.
| Compound Name | 3-butan-2-yl-2-ethyl-2-[4-(oxolan-2-ylmethoxy)phenyl]-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 54779143 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 3-butan-2-yl-2-ethyl-2-[4-(oxolan-2-ylmethoxy)phenyl]-1H-quinazolin-4-one |
| SMILES | CCC(C)N1C(=O)c2ccccc2NC1(CC)c1ccc(OCC2CCCO2)cc1 |
| InChI | InChI=1S/C25H32N2O3/c1-4-18(3)27-24(28)22-10-6-7-11-23(22)26-25(27,5-2)19-12-14-20(15-13-19)30-17-21-9-8-16-29-21/h6-7,10-15,18,21,26H,4-5,8-9,16-17H2,1-3H3 |
| InChIKey | BHQKCDVBHUNLNQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |