C22H21N3O3S — CID 32974533
[4-(pyrrolidine-1-carbonyl)phenyl]methyl 2-quinoxalin-2-ylsulfanylacetate (PubChem CID 32974533) has the molecular formula C22H21N3O3S and a molecular weight of 407.50 g/mol. Its IUPAC name is [4-(pyrrolidine-1-carbonyl)phenyl]methyl 2-quinoxalin-2-ylsulfanylacetate.
| Compound Name | [4-(pyrrolidine-1-carbonyl)phenyl]methyl 2-quinoxalin-2-ylsulfanylacetate |
|---|---|
| PubChem CID | 32974533 |
| Molecular Formula | C22H21N3O3S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | [4-(pyrrolidine-1-carbonyl)phenyl]methyl 2-quinoxalin-2-ylsulfanylacetate |
| SMILES | O=C(CSc1cnc2ccccc2n1)OCc1ccc(C(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C22H21N3O3S/c26-21(15-29-20-13-23-18-5-1-2-6-19(18)24-20)28-14-16-7-9-17(10-8-16)22(27)25-11-3-4-12-25/h1-2,5-10,13H,3-4,11-12,14-15H2 |
| InChIKey | WFYLJKNDWSGZGF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |