C20H29ClN4O — CID 3297635
4-[2-[bis(prop-2-enyl)amino]ethyl]-N-(3-chloro-4-methylphenyl)piperazine-1-carboxamide (PubChem CID 3297635) has the molecular formula C20H29ClN4O and a molecular weight of 376.93 g/mol. Its IUPAC name is 4-[2-[bis(prop-2-enyl)amino]ethyl]-N-(3-chloro-4-methylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[2-[bis(prop-2-enyl)amino]ethyl]-N-(3-chloro-4-methylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 3297635 |
| Molecular Formula | C20H29ClN4O |
| Molecular Weight | 376.93 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 4-[2-[bis(prop-2-enyl)amino]ethyl]-N-(3-chloro-4-methylphenyl)piperazine-1-carboxamide |
| SMILES | C=CCN(CC=C)CCN1CCN(C(=O)Nc2ccc(C)c(Cl)c2)CC1 |
| InChI | InChI=1S/C20H29ClN4O/c1-4-8-23(9-5-2)10-11-24-12-14-25(15-13-24)20(26)22-18-7-6-17(3)19(21)16-18/h4-7,16H,1-2,8-15H2,3H3,(H,22,26) |
| InChIKey | SADMZVZBDGHJEU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.93 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|