C15H23ClN4O — CID 63265423
3-(3-chloro-4-methylphenyl)-1-methyl-1-(2-piperazin-1-ylethyl)urea (PubChem CID 63265423) has the molecular formula C15H23ClN4O and a molecular weight of 310.83 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)-1-methyl-1-(2-piperazin-1-ylethyl)urea.
| Compound Name | 3-(3-chloro-4-methylphenyl)-1-methyl-1-(2-piperazin-1-ylethyl)urea |
|---|---|
| PubChem CID | 63265423 |
| Molecular Formula | C15H23ClN4O |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-1-methyl-1-(2-piperazin-1-ylethyl)urea |
| SMILES | Cc1ccc(NC(=O)N(C)CCN2CCNCC2)cc1Cl |
| InChI | InChI=1S/C15H23ClN4O/c1-12-3-4-13(11-14(12)16)18-15(21)19(2)9-10-20-7-5-17-6-8-20/h3-4,11,17H,5-10H2,1-2H3,(H,18,21) |
| InChIKey | KICSYOUNQOWWHQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |