C23H28N4O3 — CID 3303097
2-[6-(4-methoxyphenyl)-3-oxo-1,4-dihydropyridazin-2-yl]-N-[3-(N-methylanilino)propyl]acetamide (PubChem CID 3303097) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is 2-[6-(4-methoxyphenyl)-3-oxo-1,4-dihydropyridazin-2-yl]-N-[3-(N-methylanilino)propyl]acetamide.
| Compound Name | 2-[6-(4-methoxyphenyl)-3-oxo-1,4-dihydropyridazin-2-yl]-N-[3-(N-methylanilino)propyl]acetamide |
|---|---|
| PubChem CID | 3303097 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 2-[6-(4-methoxyphenyl)-3-oxo-1,4-dihydropyridazin-2-yl]-N-[3-(N-methylanilino)propyl]acetamide |
| SMILES | COc1ccc(C2=CCC(=O)N(CC(=O)NCCCN(C)c3ccccc3)N2)cc1 |
| InChI | InChI=1S/C23H28N4O3/c1-26(19-7-4-3-5-8-19)16-6-15-24-22(28)17-27-23(29)14-13-21(25-27)18-9-11-20(30-2)12-10-18/h3-5,7-13,25H,6,14-17H2,1-2H3,(H,24,28) |
| InChIKey | VZYYVVBBRBNERW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|